cas: 1433997-01-3 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(2-(2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy)ethoxy)propanoate, 98%, 98% (CAS 1433997-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G1L-100mg |
| cas | 1433997-01-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 2608.40 Pln | |
| Chemat | 10g | 4389.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate (CAS 1433997-01-3) is a chemical compound with the molecular formula C15H18N2O8 and a molecular weight of 354.31 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate. InChIKey: KMEJZQCDHANYJV-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O8 |
|---|---|
| Molecular weight | 354.31 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
| InChIKey | KMEJZQCDHANYJV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)