CAS 1630906-48-7 is the registry number for 1,3-Diethyl 2-[5-(ethoxycarbonyl)-3-nitropyridin-2-yl]propanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Diethyl 2-(5-ethoxycarbonyl-3-nitro-2-pyridinyl)propanedioate (CAS 1630906-48-7) is a chemical compound with the molecular formula C15H18N2O8 and a molecular weight of 354.31 g/mol. IUPAC name: diethyl 2-(5-ethoxycarbonyl-3-nitro-2-pyridinyl)propanedioate. InChIKey: RIMXWZSFQCBHBJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O8 |
|---|---|
| Molecular weight | 354.31 g/mol |
| IUPAC name | diethyl 2-(5-ethoxycarbonyl-3-nitro-2-pyridinyl)propanedioate |
| InChIKey | RIMXWZSFQCBHBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)C(C(=O)OCC)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)