cas: 1537892-36-6 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(2-(2-(2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy)ethoxy)ethoxy)propanoate, 98%, 98% (CAS 1537892-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY71-100mg |
| cas | 1537892-36-6 |
| size | 100mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1437.20 Pln | |
| Chemat | 5g | 4283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate (CAS 1537892-36-6) is a chemical compound with the molecular formula C17H22N2O9 and a molecular weight of 398.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IIXXEVQHRSMNOB-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O9 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IIXXEVQHRSMNOB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)