Products 1537892-36-6
CAS 1537892-36-6 appears in our catalog under these names: Mal-peg3-nhs ester, 95%, Mal-PEG3-NHS ester, Mal–PEG3–NHS ester, Mal-PEG3-NHS, 2,5-Dioxopyrrolidin-1-yl 3-(2-(2-(2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy)ethoxy)ethoxy)propanoate, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 2mg, 1g, 25mg, 50mg, 500mg, 5g.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate (CAS 1537892-36-6) is a chemical compound with the molecular formula C17H22N2O9 and a molecular weight of 398.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IIXXEVQHRSMNOB-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O9 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IIXXEVQHRSMNOB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)