cas: 129431-12-5 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(tritylthio)propanoate, 95% (Containing a small amount of DCC) (CAS 129431-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A850330-1g |
| cas | 129431-12-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 10g | 731.94 Pln | |
| Ambeed | 25g | 1393.88 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 458.75 Pln | |
| BLDpharm | 10g | 769.75 Pln | |
| BLDpharm | 25g | 1480.61 Pln |
| purity | 95% (Containing a small amount of DCC) |
|---|---|
| delivery time | 2-3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate (CAS 129431-12-5) is a chemical compound with the molecular formula C26H23NO4S and a molecular weight of 445.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate. InChIKey: KLOAPUSZAUJNRC-UHFFFAOYSA-N.
| Molecular formula | C26H23NO4S |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate |
| InChIKey | KLOAPUSZAUJNRC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)