CAS 129431-12-5 appears in our catalog under these names: 2，5–Dioxopyrrolidin–1–yl 3–(tritylthio)propanoate, 2,5-Dioxopyrrolidin-1-yl 3-((triphenylmethyl)sulfanyl)propanoate, 2,5-Dioxopyrrolidin-1-yl 3-(tritylthio)propanoate 95% (Containing a small amount of DCC), 2,5-Dioxopyrrolidin-1-Yl 3-(Tritylthio)Propanoate, 98%, 98%, Propanoic acid, 3-[(triphenylmethyl)thio]-, 2,5-dioxo-1-pyrrolidinyl ester, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 0,5g, 50mg, 1g, 10g, 250mg.
(2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate (CAS 129431-12-5) is a chemical compound with the molecular formula C26H23NO4S and a molecular weight of 445.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate. InChIKey: KLOAPUSZAUJNRC-UHFFFAOYSA-N.
| Molecular formula | C26H23NO4S |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-tritylsulfanylpropanoate |
| InChIKey | KLOAPUSZAUJNRC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)