cas: 1252257-56-9 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-oxo-1-(pyridin-2-yldisulfanyl)-7,10,13,16,19,22,25,28-octaoxa-4-azahentriacontan-31-oate, 95%, 95% (CAS 1252257-56-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ND5-25mg |
| cas | 1252257-56-9 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 376.40 Pln | |
| Chemat | 50mg | 568.40 Pln | |
| Chemat | 100mg | 981.20 Pln | |
| Chemat | 250mg | 2090.00 Pln | |
| Chemat | 1g | 6813.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1252257-56-9) is a chemical compound with the molecular formula C31H49N3O13S2 and a molecular weight of 735.9 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: HKFFRXQWQMCBEO-UHFFFAOYSA-N.
| Molecular formula | C31H49N3O13S2 |
|---|---|
| Molecular weight | 735.9 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | HKFFRXQWQMCBEO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCSSC2=CC=CC=N2 |
Computed by PubChem (NCBI)