cas: 1252257-56-9 — see every product listed under this CAS number, including other names
LC-PEG8-SPDP 95% (CAS 1252257-56-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A524105-25mg |
| cas | 1252257-56-9 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 526.12 Pln | |
| Ambeed | 50mg | 726.38 Pln | |
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 3474.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A524105 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1252257-56-9) is a chemical compound with the molecular formula C31H49N3O13S2 and a molecular weight of 735.9 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: HKFFRXQWQMCBEO-UHFFFAOYSA-N.
| Molecular formula | C31H49N3O13S2 |
|---|---|
| Molecular weight | 735.9 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | HKFFRXQWQMCBEO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCSSC2=CC=CC=N2 |
Computed by PubChem (NCBI)