cas: 1599472-25-9 — see every product listed under this CAS number, including other names
2,5-dioxopyrrolidin-1-yl 1-(2,5-dioxo-2H-pyrrol-1(5H)-yl)-3,6,9,12,15,18-hexaoxahenicosan-21-oate, 95%, 95% (CAS 1599472-25-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RJC-50mg |
| cas | 1599472-25-9 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 270.80 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| Chemat | 5g | 5670.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1599472-25-9) is a chemical compound with the molecular formula C23H34N2O12 and a molecular weight of 530.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: UUNUCVXNAHYFJP-UHFFFAOYSA-N.
| Molecular formula | C23H34N2O12 |
|---|---|
| Molecular weight | 530.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | UUNUCVXNAHYFJP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)