Products 1599472-25-9
CAS 1599472-25-9 appears in our catalog under these names: Mal–PEG6–NHS ester, Mal-peg6-nhs ester, 95%, Mal-PEG6-NHS ester, Mal-PEG6-NHS, Mal-PEG6-NHS ester 95%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 25mg, 100mg, 250mg, 1g, 2mg, 50mg, 500mg, 5g.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1599472-25-9) is a chemical compound with the molecular formula C23H34N2O12 and a molecular weight of 530.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: UUNUCVXNAHYFJP-UHFFFAOYSA-N.
| Molecular formula | C23H34N2O12 |
|---|---|
| Molecular weight | 530.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | UUNUCVXNAHYFJP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)