cas: 1353011-74-1 — see every product listed under this CAS number, including other names
2,5-dioxopyrrolidin-1-yl 1-[(4-formylphenyl)formamido]-3,6,9,12-tetraoxapentadecan-15-oate, 95%, 95% (CAS 1353011-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G1H-100mg |
| cas | 1353011-74-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1418.00 Pln | |
| Chemat | 5g | 4816.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1353011-74-1) is a chemical compound with the molecular formula C23H30N2O10 and a molecular weight of 494.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: QUFDNMPGNAZKHD-UHFFFAOYSA-N.
| Molecular formula | C23H30N2O10 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | QUFDNMPGNAZKHD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)