cas: 1353011-74-1 — see every product listed under this CAS number, including other names
Ald-Ph-amido-PEG4-C2-NHS ester 95% (CAS 1353011-74-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A941359-5g |
| cas | 1353011-74-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 5899.50 Pln | |
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1733.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A941359 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1353011-74-1) is a chemical compound with the molecular formula C23H30N2O10 and a molecular weight of 494.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: QUFDNMPGNAZKHD-UHFFFAOYSA-N.
| Molecular formula | C23H30N2O10 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | QUFDNMPGNAZKHD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)