cas: 23827-28-3 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridin-3-amine hydrochloride, 98%, 98% (CAS 23827-28-3) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XHWX-250g |
| cas | 23827-28-3 |
| size | 250g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 10389.20 Pln | |
| Chemat | 500g | 17846.40 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 2541.20 Pln | |
| Chemat | 100g | 4888.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride (CAS 23827-28-3) is a chemical compound with the molecular formula C19H19ClN2O2 and a molecular weight of 342.8 g/mol. IUPAC name: 2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride. InChIKey: BHXWFZWKLXWIHM-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride |
| InChIKey | BHXWFZWKLXWIHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=C(C=C2)N)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)