2,6-Bis(benzyloxy)pyridine, 97%
cas: 16727-46-1 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridine, 97% (CAS 16727-46-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A677089-1g |
| cas | 16727-46-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 25g | 2317.25 Pln | |
| Ambeed | 100g | 5677.00 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 814.18 Pln | |
| BLDpharm | 25g | 2496.92 Pln | |
| BLDpharm | 100g | 6117.87 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 180.16 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 679.99 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,6-bis(phenylmethoxy)pyridine (CAS 16727-46-1) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2,6-bis(phenylmethoxy)pyridine. InChIKey: IREZYNKPQCIUME-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2,6-bis(phenylmethoxy)pyridine |
| InChIKey | IREZYNKPQCIUME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)