cas: 16727-46-1 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridine, 97% (CAS 16727-46-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212961-1G |
| cas | 16727-46-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 643.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-bis(phenylmethoxy)pyridine (CAS 16727-46-1) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2,6-bis(phenylmethoxy)pyridine. InChIKey: IREZYNKPQCIUME-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2,6-bis(phenylmethoxy)pyridine |
| InChIKey | IREZYNKPQCIUME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)