2,6-Bis(diphenylamino)anthracene-9,10-dione, 95+%
cas: 868850-50-4 — see every product listed under this CAS number, including other names
2,6-Bis(diphenylamino)anthracene-9,10-dione, 95+% (CAS 868850-50-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A906041-250mg |
| cas | 868850-50-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 2171.60 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 414.32 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
2,6-bis(N-phenylanilino)anthracene-9,10-dione (CAS 868850-50-4) is a chemical compound with the molecular formula C38H26N2O2 and a molecular weight of 542.6 g/mol. IUPAC name: 2,6-bis(N-phenylanilino)anthracene-9,10-dione. InChIKey: TZENEWLXCXPNFX-UHFFFAOYSA-N.
| Molecular formula | C38H26N2O2 |
|---|---|
| Molecular weight | 542.6 g/mol |
| IUPAC name | 2,6-bis(N-phenylanilino)anthracene-9,10-dione |
| InChIKey | TZENEWLXCXPNFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C(=O)C5=C(C4=O)C=CC(=C5)N(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)
Synonyms:
2,6-bis(diphenylamino)anthracene-9,10-dione, 2,6-Bis(diphenylamino)anthraquinone, 2,6-bis(N-phenylanilino)anthracene-9,10-dione, 9,10-Anthracenedione, 2,6-bis(diphenylamino)-, 2,6-Bis-(diphenylamino)-9,10-anthracenedione, n,n,n',n'-tetraphenyl-2,6-diamino-9,10-anthracenedione, 2,6-Bis(diphenylami, 2,6-bis(diphenylamino)-9,10-Anthracenedione, TZENEWLXCXPNFX-UHFFFAOYSA-N
