CAS 868850-50-4 appears in our catalog under these names: 2,6-Bis(diphenylamino)anthracene-9,10-dione, 95%, 2,6–Bis(diphenylamino)anthraquinone, 2,6-Bis(diphenylamino)anthraquinone, >96.0%(HPLC)(N), 2,6-Bis(diphenylamino)anthraquinone, 2,6-Bis(diphenylamino)anthracene-9,10-dione 95+%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 200mg, 1g, 100mg, 250mg, 10000mg, 5000mg, 5g.
2,6-bis(N-phenylanilino)anthracene-9,10-dione (CAS 868850-50-4) is a chemical compound with the molecular formula C38H26N2O2 and a molecular weight of 542.6 g/mol. IUPAC name: 2,6-bis(N-phenylanilino)anthracene-9,10-dione. InChIKey: TZENEWLXCXPNFX-UHFFFAOYSA-N.
| Molecular formula | C38H26N2O2 |
|---|---|
| Molecular weight | 542.6 g/mol |
| IUPAC name | 2,6-bis(N-phenylanilino)anthracene-9,10-dione |
| InChIKey | TZENEWLXCXPNFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C(=O)C5=C(C4=O)C=CC(=C5)N(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)