cas: 408492-27-3 — see every product listed under this CAS number, including other names
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE, 98%, 98% (CAS 408492-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250g, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G3R-250g |
| cas | 408492-27-3 |
| size | 250g |
| availability | 601.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 3990.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 654.80 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1806.80 Pln | |
| Chemat | 500g | 6936.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 408492-27-3) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PEFDHAOFDBNZEQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PEFDHAOFDBNZEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)