cas: 408492-27-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95% (CAS 408492-27-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212612-5G |
| cas | 408492-27-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 10g | 471.73 Pln | |
| Fluorochem | 25g | 877.83 Pln | |
| Fluorochem | 100g | 3298.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 408492-27-3) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PEFDHAOFDBNZEQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PEFDHAOFDBNZEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)