cas: 762229-49-2 — see every product listed under this CAS number, including other names
2,6-DIFLUORO-BENZAMIDINE, 97%, 97% (CAS 762229-49-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116EVE-100mg |
| cas | 762229-49-2 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 4533.20 Pln | |
| Chemat | 10g | 5598.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-difluorobenzenecarboximidamide (CAS 762229-49-2) is a chemical compound with the molecular formula C7H6F2N2 and a molecular weight of 156.13 g/mol. IUPAC name: 2,6-difluorobenzenecarboximidamide. InChIKey: VCGXHAPBHZDDDJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2 |
|---|---|
| Molecular weight | 156.13 g/mol |
| IUPAC name | 2,6-difluorobenzenecarboximidamide |
| InChIKey | VCGXHAPBHZDDDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=N)N)F |
Computed by PubChem (NCBI)