cas: 762229-49-2 — see every product listed under this CAS number, including other names
2,6-Difluorobenzimidamide, 97% (CAS 762229-49-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A431577-10g |
| cas | 762229-49-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 20687.17 Pln | |
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 721.64 Pln | |
| Fluorochem | 1g | 2111.77 Pln | |
| Fluorochem | 5g | 7516.12 Pln | |
| Fluorochem | 10g | 9291.54 Pln | |
| Fluorochem | 25g | 23146.03 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-difluorobenzenecarboximidamide (CAS 762229-49-2) is a chemical compound with the molecular formula C7H6F2N2 and a molecular weight of 156.13 g/mol. IUPAC name: 2,6-difluorobenzenecarboximidamide. InChIKey: VCGXHAPBHZDDDJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2 |
|---|---|
| Molecular weight | 156.13 g/mol |
| IUPAC name | 2,6-difluorobenzenecarboximidamide |
| InChIKey | VCGXHAPBHZDDDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=N)N)F |
Computed by PubChem (NCBI)