cas: 10396-80-2 — see every product listed under this CAS number, including other names
2,6-Di-tert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one, 98% (CAS 10396-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F765650-100MG |
| cas | 10396-80-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 627.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-ditert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one (CAS 10396-80-2) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: 2,6-ditert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one. InChIKey: DQBHJILNHNRDTM-UHFFFAOYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one |
| InChIKey | DQBHJILNHNRDTM-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C)O |
Computed by PubChem (NCBI)