CAS 83803-80-9 appears in our catalog under these names: 4-Butylbenzaldehyde diethyl acetal, 95%, 1-Butyl-4-(diethoxymethyl)benzene, 97%, 4–Butylbenzaldehyde Diethyl Acetal, 4-Butylbenzaldehyde Diethyl Acetal, 4-Butylbenzaldehyde Diethyl Acetal, >97.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 1ml, 5ml, 25ml.
1-butyl-4-(diethoxymethyl)benzene (CAS 83803-80-9) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: 1-butyl-4-(diethoxymethyl)benzene. InChIKey: VZIJDIWCWDYVFM-UHFFFAOYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 1-butyl-4-(diethoxymethyl)benzene |
| InChIKey | VZIJDIWCWDYVFM-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)C(OCC)OCC |
Computed by PubChem (NCBI)