cas: 489-01-0 — see every product listed under this CAS number, including other names
2,6-Di-tert-butyl-4-methoxyphenol 95% (CAS 489-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A692407-1g |
| cas | 489-01-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1443.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A692407 |
2,6-di-tert-butyl-4-methoxyphenol is a member of phenols and a member of methoxybenzenes.
Source: ChEBI
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-methoxyphenol |
| InChIKey | SLUKQUGVTITNSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)OC |
Computed by PubChem (NCBI)