cas: 1588440-97-4 — see every product listed under this CAS number, including other names
2,6-Diazaspiro(3.4)octan-7-one oxalate, 98+% (CAS 1588440-97-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A232972-25g |
| cas | 1588440-97-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10694.32 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-diazaspiro[3.4]octan-7-one;oxalic acid (CAS 1588440-97-4) is a chemical compound with the molecular formula C8H12N2O5 and a molecular weight of 216.19 g/mol. IUPAC name: 2,6-diazaspiro[3.4]octan-7-one;oxalic acid. InChIKey: PRWNGIQBMCOERR-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O5 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 2,6-diazaspiro[3.4]octan-7-one;oxalic acid |
| InChIKey | PRWNGIQBMCOERR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)