Products 1588440-97-4

CAS 1588440-97-4 appears in our catalog under these names: 2,6-Diazaspiro[3.4]octan-7-one oxalate, 95%, 2,6-Diazaspiro(3.4)octan-7-one oxalate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 25g.

Structural formula: {0} (CAS {1})

2,6-diazaspiro[3.4]octan-7-one;oxalic acid (CAS 1588440-97-4) is a chemical compound with the molecular formula C8H12N2O5 and a molecular weight of 216.19 g/mol. IUPAC name: 2,6-diazaspiro[3.4]octan-7-one;oxalic acid. InChIKey: PRWNGIQBMCOERR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O5
Molecular weight216.19 g/mol
IUPAC name2,6-diazaspiro[3.4]octan-7-one;oxalic acid
InChIKeyPRWNGIQBMCOERR-UHFFFAOYSA-N
SMILESC1C(=O)NCC12CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)