2,6-Dichloro-3-nitrobenzaldehyde, 98%
cas: 5866-97-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-nitrobenzaldehyde, 98% (CAS 5866-97-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A294623-1g |
| cas | 5866-97-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 993.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 1069.65 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 310.32 Pln | |
| Fluorochem | 100g | 1023.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dichloro-3-nitrobenzaldehyde (CAS 5866-97-7) is a chemical compound with the molecular formula C7H3Cl2NO3 and a molecular weight of 220.01 g/mol. IUPAC name: 2,6-dichloro-3-nitrobenzaldehyde. InChIKey: CQOQHGBSJIWOCA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO3 |
|---|---|
| Molecular weight | 220.01 g/mol |
| IUPAC name | 2,6-dichloro-3-nitrobenzaldehyde |
| InChIKey | CQOQHGBSJIWOCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)C=O)Cl |
Computed by PubChem (NCBI)