Products 2837903-61-2
CAS 2837903-61-2 appears in our catalog under these names: 4,6-Dichloro-3-hydroxyfuro[3,4-c]pyridin-1(3H)-one 95%, 4,6-Dichloro-3-hydroxyfuro[3,4-c]pyridin-1(3H)-one, 95%, 95%, 4,6-Dichloro-3-hydroxyfuro[3,4-c]pyridin-1(3H)-one, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4,6-dichloro-3-hydroxy-3H-furo[3,4-c]pyridin-1-one (CAS 2837903-61-2) is a chemical compound with the molecular formula C7H3Cl2NO3 and a molecular weight of 220.01 g/mol. IUPAC name: 4,6-dichloro-3-hydroxy-3H-furo[3,4-c]pyridin-1-one. InChIKey: DEKHWDKWCDXKKH-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO3 |
|---|---|
| Molecular weight | 220.01 g/mol |
| IUPAC name | 4,6-dichloro-3-hydroxy-3H-furo[3,4-c]pyridin-1-one |
| InChIKey | DEKHWDKWCDXKKH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)C(OC2=O)O |
Computed by PubChem (NCBI)