cas: 18700-11-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-phenylpyridine, 98% (CAS 18700-11-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324966-100MG |
| cas | 18700-11-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 372.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dichloro-3-phenylpyridine (CAS 18700-11-3) is a chemical compound with the molecular formula C11H7Cl2N and a molecular weight of 224.08 g/mol. IUPAC name: 2,6-dichloro-3-phenylpyridine. InChIKey: MTUMHWPBSOBUCL-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2,6-dichloro-3-phenylpyridine |
| InChIKey | MTUMHWPBSOBUCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)