CAS 18700-11-3 appears in our catalog under these names: 2,6–Dichloro–3–phenylpyridine, 2,6-Dichloro-3-phenylpyridine, 95%, 2,6-Dichloro-3-phenylpyridine, 98%, 2,6-Dichloro-3-phenylpyridine, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-3-phenylpyridine (CAS 18700-11-3) is a chemical compound with the molecular formula C11H7Cl2N and a molecular weight of 224.08 g/mol. IUPAC name: 2,6-dichloro-3-phenylpyridine. InChIKey: MTUMHWPBSOBUCL-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2,6-dichloro-3-phenylpyridine |
| InChIKey | MTUMHWPBSOBUCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)