cas: 80866-96-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(methylsulfonyl)aniline, 95%, 95% (CAS 80866-96-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116IB4-250mg |
| cas | 80866-96-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-methylsulfonylaniline (CAS 80866-96-2) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 2,6-dichloro-4-methylsulfonylaniline. InChIKey: JMVVMLXAGZVYMB-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 2,6-dichloro-4-methylsulfonylaniline |
| InChIKey | JMVVMLXAGZVYMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)