CAS 80866-96-2 appears in our catalog under these names: 2,6-Dichloro-4-(methylsulfonyl)aniline, 98%, 2,6-Dichloro-4-(methylsulfonyl)aniline 95%, 2,6-Dichloro-4-(methylsulfonyl)aniline, 95%, 95%, 2,6-Dichloro-4-(methylsulfonyl)aniline, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
2,6-dichloro-4-methylsulfonylaniline (CAS 80866-96-2) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 2,6-dichloro-4-methylsulfonylaniline. InChIKey: JMVVMLXAGZVYMB-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 2,6-dichloro-4-methylsulfonylaniline |
| InChIKey | JMVVMLXAGZVYMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)