cas: 175205-76-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(trifluoromethyl)benzenesulfonylchloride (CAS 175205-76-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004743-1G |
| cas | 175205-76-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 175205-76-2) is a chemical compound with the molecular formula C7H2Cl3F3O2S and a molecular weight of 313.5 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: MRGIKDMKHORAMU-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3F3O2S |
|---|---|
| Molecular weight | 313.5 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | MRGIKDMKHORAMU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)