CAS 175205-76-2 appears in our catalog under these names: 2,6-Dichloro-4-(trifluoromethyl)benzenesulfonyl chloride, 95%, 2,6-Dichloro-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 2,6-Dichloro-4-(trifluoromethyl)benzenesulfonylchloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 175205-76-2) is a chemical compound with the molecular formula C7H2Cl3F3O2S and a molecular weight of 313.5 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: MRGIKDMKHORAMU-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3F3O2S |
|---|---|
| Molecular weight | 313.5 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | MRGIKDMKHORAMU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)