cas: 1260758-33-5 — see every product listed under this CAS number, including other names
2,6-Dichloro-5-fluoronicotinaldehyde, 95%, 95% (CAS 1260758-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ASC-100mg |
| cas | 1260758-33-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2723.60 Pln | |
| Chemat | 10g | 4317.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-5-fluoropyridine-3-carbaldehyde (CAS 1260758-33-5) is a chemical compound with the molecular formula C6H2Cl2FNO and a molecular weight of 193.99 g/mol. IUPAC name: 2,6-dichloro-5-fluoropyridine-3-carbaldehyde. InChIKey: PVYGHERNXKCTOM-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoropyridine-3-carbaldehyde |
| InChIKey | PVYGHERNXKCTOM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)C=O |
Computed by PubChem (NCBI)