Products 2460748-78-9
CAS 2460748-78-9 appears in our catalog under these names: 2,6-Dichloro-3-fluoroisonicotinaldehyde, ≥95%, 2,6-dichloro-3-fluoropyridine-4-carbaldehyde, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
2,6-dichloro-3-fluoropyridine-4-carbaldehyde (CAS 2460748-78-9) is a chemical compound with the molecular formula C6H2Cl2FNO and a molecular weight of 193.99 g/mol. IUPAC name: 2,6-dichloro-3-fluoropyridine-4-carbaldehyde. InChIKey: SWJROHZMWXYHPT-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 2,6-dichloro-3-fluoropyridine-4-carbaldehyde |
| InChIKey | SWJROHZMWXYHPT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)F)C=O |
Computed by PubChem (NCBI)