cas: 1416351-81-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-5-fluoropyridin-3-amine hydrochloride, 95% (CAS 1416351-81-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25g. Offered by: Combi-blocks, AmBeed.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-7897-1g |
| cas | 1416351-81-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| AmBeed | 1g | 265.30 Pln | |
| AmBeed | 250mg | 135.10 Pln | |
| AmBeed | 100mg | 102.55 Pln | |
| AmBeed | 25g | 2986.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride (CAS 1416351-81-9) is a chemical compound with the molecular formula C5H4Cl3FN2 and a molecular weight of 217.45 g/mol. IUPAC name: 2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride. InChIKey: JFQLVKUUCAWWGV-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl3FN2 |
|---|---|
| Molecular weight | 217.45 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride |
| InChIKey | JFQLVKUUCAWWGV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)