CAS 1416351-81-9 appears in our catalog under these names: 2,6-Dichloro-5-fluoropyridin-3-amine hydrochloride, 95%, 2,6–Dichloro–5–fluoropyridin–3–amine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25g.
2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride (CAS 1416351-81-9) is a chemical compound with the molecular formula C5H4Cl3FN2 and a molecular weight of 217.45 g/mol. IUPAC name: 2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride. InChIKey: JFQLVKUUCAWWGV-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl3FN2 |
|---|---|
| Molecular weight | 217.45 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoropyridin-3-amine;hydrochloride |
| InChIKey | JFQLVKUUCAWWGV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)