cas: 1008119-07-0 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97% (CAS 1008119-07-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231134-250MG |
| cas | 1008119-07-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 25g | 2778.21 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1008119-07-0) is a chemical compound with the molecular formula C13H15BF2O4 and a molecular weight of 284.07 g/mol. IUPAC name: 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: OGQFSRYMVQGPRZ-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O4 |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | OGQFSRYMVQGPRZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)