CAS 2377606-94-3 is the registry number for 3,4-Difluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3,4-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377606-94-3) is a chemical compound with the molecular formula C13H15BF2O4 and a molecular weight of 284.07 g/mol. IUPAC name: 3,4-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: OSRPRCIGDLJIGG-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O4 |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 3,4-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | OSRPRCIGDLJIGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)