cas: 433939-88-9 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-formylbenzonitrile 98% (CAS 433939-88-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A455727-250mg |
| cas | 433939-88-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2812.31 Pln | |
| Ambeed | 100g | 8853.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A455727 |
2,6-difluoro-4-formylbenzonitrile (CAS 433939-88-9) is a chemical compound with the molecular formula C8H3F2NO and a molecular weight of 167.11 g/mol. IUPAC name: 2,6-difluoro-4-formylbenzonitrile. InChIKey: TUOLCSUKMUVDOE-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO |
|---|---|
| Molecular weight | 167.11 g/mol |
| IUPAC name | 2,6-difluoro-4-formylbenzonitrile |
| InChIKey | TUOLCSUKMUVDOE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C#N)F)C=O |
Computed by PubChem (NCBI)