CAS 149489-14-5 appears in our catalog under these names: 2,4-Difluoro-3-formylbenzonitrile, 98%, 2,4–Difluoro–3–formylbenzonitrile, 2,4-Difluoro-3-formylbenzonitrile, >95%, >95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g.
2,4-difluoro-3-formylbenzonitrile (CAS 149489-14-5) is a chemical compound with the molecular formula C8H3F2NO and a molecular weight of 167.11 g/mol. IUPAC name: 2,4-difluoro-3-formylbenzonitrile. InChIKey: SONFDGCKTXJMSD-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO |
|---|---|
| Molecular weight | 167.11 g/mol |
| IUPAC name | 2,4-difluoro-3-formylbenzonitrile |
| InChIKey | SONFDGCKTXJMSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)C=O)F |
Computed by PubChem (NCBI)