CAS 18063-02-0 appears in our catalog under these names: 2,6–Difluorobenzoyl Chloride, 2,6-Difluorobenzoyl chloride, 98% , 2,6-Difluorobenzoyl chloride, 2,6-Difluorobenzoyl Chloride, >97.0%(GC)(T), 2,6-Difluorobenzoyl chloride, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Fluorochem. Available pack sizes: 100g, 25g, 5g, 50g, 250g, 500g.
2,6-difluorobenzoyl chloride (CAS 18063-02-0) is a chemical compound with the molecular formula C7H3ClF2O and a molecular weight of 176.55 g/mol. IUPAC name: 2,6-difluorobenzoyl chloride. InChIKey: QRHUZEVERIHEPT-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O |
|---|---|
| Molecular weight | 176.55 g/mol |
| IUPAC name | 2,6-difluorobenzoyl chloride |
| InChIKey | QRHUZEVERIHEPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)Cl)F |
Computed by PubChem (NCBI)