Products 18355-73-2
CAS 18355-73-2 appears in our catalog under these names: 2,3-Difluorobenzoyl chloride, 97%, 2,3–Difluorobenzoyl chloride, 2,3-Difluorobenzoyl chloride, 98%, 2,3-Difluorobenzoylchloride, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2,3-difluorobenzoyl chloride (CAS 18355-73-2) is a chemical compound with the molecular formula C7H3ClF2O and a molecular weight of 176.55 g/mol. IUPAC name: 2,3-difluorobenzoyl chloride. InChIKey: CDCFERWURRNLLA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O |
|---|---|
| Molecular weight | 176.55 g/mol |
| IUPAC name | 2,3-difluorobenzoyl chloride |
| InChIKey | CDCFERWURRNLLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)Cl |
Computed by PubChem (NCBI)