2,6-Dimethoxybenzenesulfonyl Chloride, 95%, 95%
cas: 145980-89-8 — see every product listed under this CAS number, including other names
2,6-Dimethoxybenzenesulfonyl Chloride, 95%, 95% (CAS 145980-89-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AD6B-10g |
| cas | 145980-89-8 |
| size | 10g |
| availability | 400g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 760.40 Pln | |
| Chemat | 100g | 6266.00 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 25g | 1706.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethoxybenzenesulfonyl chloride (CAS 145980-89-8) is a chemical compound with the molecular formula C8H9ClO4S and a molecular weight of 236.67 g/mol. IUPAC name: 2,6-dimethoxybenzenesulfonyl chloride. InChIKey: KLVZDQNSNTUNGU-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO4S |
|---|---|
| Molecular weight | 236.67 g/mol |
| IUPAC name | 2,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | KLVZDQNSNTUNGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)