cas: 15644-82-3 — see every product listed under this CAS number, including other names
2,6-Dimethylquinolin-4-ol, 97%, 97% (CAS 15644-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYDW-250mg |
| cas | 15644-82-3 |
| size | 250mg |
| availability | 40g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 500mg | 189.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 1106.00 Pln | |
| Chemat | 25g | 2598.80 Pln | |
| Chemat | 100mg | 117.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-1H-quinolin-4-one (CAS 15644-82-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,6-dimethyl-1H-quinolin-4-one. InChIKey: LSWRRPBOJDRHSV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,6-dimethyl-1H-quinolin-4-one |
| InChIKey | LSWRRPBOJDRHSV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=CC2=O)C |
Computed by PubChem (NCBI)