CAS 15644-82-3 appears in our catalog under these names: 2,6-dimethylquinolin-4-ol, 95%, 2,6-Dimethylquinolin-4-ol, 98%, 2,6-Dimethyl-4-hydroxyquinoline, 2,6-Dimethylquinolin-4-ol 98%, 2,6-Dimethylquinolin-4-ol, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 500mg, 100mg.
2,6-dimethyl-1H-quinolin-4-one (CAS 15644-82-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,6-dimethyl-1H-quinolin-4-one. InChIKey: LSWRRPBOJDRHSV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,6-dimethyl-1H-quinolin-4-one |
| InChIKey | LSWRRPBOJDRHSV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=CC2=O)C |
Computed by PubChem (NCBI)