CAS 43036-58-4 is the registry number for 2,6-Diphenylbenzo[1,2-d:4,5-d']bis(oxazole), 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2,6-diphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole (CAS 43036-58-4) is a chemical compound with the molecular formula C20H12N2O2 and a molecular weight of 312.3 g/mol. IUPAC name: 2,6-diphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole. InChIKey: BLLMMJIVVDXJPO-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O2 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 2,6-diphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| InChIKey | BLLMMJIVVDXJPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC4=C(C=C3O2)N=C(O4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)