CAS 28999-67-9 is the registry number for 2,6-Diphenylbenzo[1,2-d:5,4-d']bisoxazole, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole (CAS 28999-67-9) is a chemical compound with the molecular formula C20H12N2O2 and a molecular weight of 312.3 g/mol. IUPAC name: 2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole. InChIKey: MAWIWSCASQSZCD-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O2 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole |
| InChIKey | MAWIWSCASQSZCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC4=C(C=C3O2)OC(=N4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)