Products 28999-67-9

CAS 28999-67-9 is the registry number for 2,6-Diphenylbenzo[1,2-d:5,4-d']bisoxazole, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole (CAS 28999-67-9) is a chemical compound with the molecular formula C20H12N2O2 and a molecular weight of 312.3 g/mol. IUPAC name: 2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole. InChIKey: MAWIWSCASQSZCD-UHFFFAOYSA-N.

Identity
Molecular formulaC20H12N2O2
Molecular weight312.3 g/mol
IUPAC name2,6-diphenyl-[1,3]oxazolo[4,5-f][1,3]benzoxazole
InChIKeyMAWIWSCASQSZCD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=CC4=C(C=C3O2)OC(=N4)C5=CC=CC=C5

Computed by PubChem (NCBI)