cas: 132717-37-4 — see every product listed under this CAS number, including other names
2,7-Dibromo-9-phenyl-9H-fluoren-9-ol, >98.0%(GC) (CAS 132717-37-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5448-5G |
| cas | 132717-37-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 290.45 Pln | |
| TCI | 25g | 885.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,7-dibromo-9-phenylfluoren-9-ol (CAS 132717-37-4) is a chemical compound with the molecular formula C19H12Br2O and a molecular weight of 416.1 g/mol. IUPAC name: 2,7-dibromo-9-phenylfluoren-9-ol. InChIKey: VGZUBRZNTWOSTO-UHFFFAOYSA-N.
| Molecular formula | C19H12Br2O |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | 2,7-dibromo-9-phenylfluoren-9-ol |
| InChIKey | VGZUBRZNTWOSTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)O |
Computed by PubChem (NCBI)