CAS 132717-37-4 appears in our catalog under these names: 2,7-Dibromo-9-phenyl-9h-fluoren-9-ol, 98%, 2,7–Dibromo–9–phenyl–9H–fluoren–9–ol, 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol, >98.0%(GC), 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol, 95%, 95%, 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 250mg.
2,7-dibromo-9-phenylfluoren-9-ol (CAS 132717-37-4) is a chemical compound with the molecular formula C19H12Br2O and a molecular weight of 416.1 g/mol. IUPAC name: 2,7-dibromo-9-phenylfluoren-9-ol. InChIKey: VGZUBRZNTWOSTO-UHFFFAOYSA-N.
| Molecular formula | C19H12Br2O |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | 2,7-dibromo-9-phenylfluoren-9-ol |
| InChIKey | VGZUBRZNTWOSTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)O |
Computed by PubChem (NCBI)